CAS 1799442-84-4 is the registry number for (E)-Methyl 5-(4-bromophenyl)-5-(hydroxyimino)pentanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl (5E)-5-(4-bromophenyl)-5-hydroxyiminopentanoate (CAS 1799442-84-4) is a chemical compound with the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. IUPAC name: methyl (5E)-5-(4-bromophenyl)-5-hydroxyiminopentanoate. InChIKey: PEHBOZLIIUCWMP-SDNWHVSQSA-N.
| Molecular formula | C12H14BrNO3 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | methyl (5E)-5-(4-bromophenyl)-5-hydroxyiminopentanoate |
| InChIKey | PEHBOZLIIUCWMP-SDNWHVSQSA-N |
| SMILES | COC(=O)CCC/C(=N\O)/C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)