CAS 151096-42-3 is the registry number for 2-Bromo-3,4,5,6-tetrafluorobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
2-bromo-3,4,5,6-tetrafluorobenzoyl chloride (CAS 151096-42-3) is a chemical compound with the molecular formula C7BrClF4O and a molecular weight of 291.42 g/mol. IUPAC name: 2-bromo-3,4,5,6-tetrafluorobenzoyl chloride. InChIKey: FLVURBOAHUGHCH-UHFFFAOYSA-N.
| Molecular formula | C7BrClF4O |
|---|---|
| Molecular weight | 291.42 g/mol |
| IUPAC name | 2-bromo-3,4,5,6-tetrafluorobenzoyl chloride |
| InChIKey | FLVURBOAHUGHCH-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Br)F)F)F)F)C(=O)Cl |
Computed by PubChem (NCBI)