Products 151096-42-3

CAS 151096-42-3 is the registry number for 2-Bromo-3,4,5,6-tetrafluorobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-bromo-3,4,5,6-tetrafluorobenzoyl chloride (CAS 151096-42-3) is a chemical compound with the molecular formula C7BrClF4O and a molecular weight of 291.42 g/mol. IUPAC name: 2-bromo-3,4,5,6-tetrafluorobenzoyl chloride. InChIKey: FLVURBOAHUGHCH-UHFFFAOYSA-N.

Identity
Molecular formulaC7BrClF4O
Molecular weight291.42 g/mol
IUPAC name2-bromo-3,4,5,6-tetrafluorobenzoyl chloride
InChIKeyFLVURBOAHUGHCH-UHFFFAOYSA-N
SMILESC1(=C(C(=C(C(=C1Br)F)F)F)F)C(=O)Cl

Computed by PubChem (NCBI)