Products 292621-46-6

CAS 292621-46-6 is the registry number for 3-Bromo-2,4,5,6-tetrafluorobenzoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

3-bromo-2,4,5,6-tetrafluorobenzoyl chloride (CAS 292621-46-6) is a chemical compound with the molecular formula C7BrClF4O and a molecular weight of 291.42 g/mol. IUPAC name: 3-bromo-2,4,5,6-tetrafluorobenzoyl chloride. InChIKey: FHHUFCXIDZNVQW-UHFFFAOYSA-N.

Identity
Molecular formulaC7BrClF4O
Molecular weight291.42 g/mol
IUPAC name3-bromo-2,4,5,6-tetrafluorobenzoyl chloride
InChIKeyFHHUFCXIDZNVQW-UHFFFAOYSA-N
SMILESC1(=C(C(=C(C(=C1F)Br)F)F)F)C(=O)Cl

Computed by PubChem (NCBI)