CAS 1510965-06-6 appears in our catalog under these names: 4-Chloro-3-azatricyclo(6.2.1.0,2,7)undeca-2(7),3,5-triene-5-carbonitrile, 95%, 4-Chloro-3-azatricyclo(6.2.1.0,2,7)undeca-2(7),3,5-triene-5-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-chloro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile (CAS 1510965-06-6) is a chemical compound with the molecular formula C11H9ClN2 and a molecular weight of 204.65 g/mol. IUPAC name: 4-chloro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile. InChIKey: AFMFLAFHRUXVRV-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 4-chloro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile |
| InChIKey | AFMFLAFHRUXVRV-UHFFFAOYSA-N |
| SMILES | C1CC2CC1C3=C2N=C(C(=C3)C#N)Cl |
Computed by PubChem (NCBI)