Products 1510992-26-3
CAS 1510992-26-3 is the registry number for 6-Bromo-1-cyclopentyl-1h-indole-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-1-cyclopentylindole-3-carbonitrile (CAS 1510992-26-3) is a chemical compound with the molecular formula C14H13BrN2 and a molecular weight of 289.17 g/mol. IUPAC name: 6-bromo-1-cyclopentylindole-3-carbonitrile. InChIKey: RSXZKPPBPMCZCX-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2 |
|---|---|
| Molecular weight | 289.17 g/mol |
| IUPAC name | 6-bromo-1-cyclopentylindole-3-carbonitrile |
| InChIKey | RSXZKPPBPMCZCX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C=C(C3=C2C=C(C=C3)Br)C#N |
Computed by PubChem (NCBI)