Products 1779794-82-9
CAS 1779794-82-9 is the registry number for 5-(4-Bromophenyl)-2-cyclopropyl-4-methylpyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-(4-bromophenyl)-2-cyclopropyl-4-methylpyrimidine (CAS 1779794-82-9) is a chemical compound with the molecular formula C14H13BrN2 and a molecular weight of 289.17 g/mol. IUPAC name: 5-(4-bromophenyl)-2-cyclopropyl-4-methylpyrimidine. InChIKey: UWAQYZWJIVGXHJ-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2 |
|---|---|
| Molecular weight | 289.17 g/mol |
| IUPAC name | 5-(4-bromophenyl)-2-cyclopropyl-4-methylpyrimidine |
| InChIKey | UWAQYZWJIVGXHJ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC=C1C2=CC=C(C=C2)Br)C3CC3 |
Computed by PubChem (NCBI)