CAS 1511636-19-3 is the registry number for 2-(3,5-Difluorophenyl)cyclopropanamine. Offered by: TRC. Available pack sizes: 250mg.
2-(3,5-difluorophenyl)cyclopropan-1-amine (CAS 1511636-19-3) is a chemical compound with the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. IUPAC name: 2-(3,5-difluorophenyl)cyclopropan-1-amine. InChIKey: XLQLRKKOZIANSJ-UHFFFAOYSA-N.
| Molecular formula | C9H9F2N |
|---|---|
| Molecular weight | 169.17 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)cyclopropan-1-amine |
| InChIKey | XLQLRKKOZIANSJ-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)