CAS 1511845-31-0 is the registry number for 8-Methoxy-6-methylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-methoxy-6-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1511845-31-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 8-methoxy-6-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: WJAAQBNPXDNGMK-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 8-methoxy-6-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | WJAAQBNPXDNGMK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)OC)OCC(C2)C(=O)O |
Computed by PubChem (NCBI)