CAS 151213-41-1 appears in our catalog under these names: Moxifloxacin Impurity 122, (1S,6R)-8-Benzyl-7,9-dioxo-2,8-diazabicyclo(4.3.0)nonane. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(4aR,7aS)-6-benzyl-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridine-5,7-dione (CAS 151213-41-1) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: (4aR,7aS)-6-benzyl-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridine-5,7-dione. InChIKey: RRBLNPCNHNHAFW-NEPJUHHUSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (4aR,7aS)-6-benzyl-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridine-5,7-dione |
| InChIKey | RRBLNPCNHNHAFW-NEPJUHHUSA-N |
| SMILES | C1C[C@@H]2[C@@H](C(=O)N(C2=O)CC3=CC=CC=C3)NC1 |
Computed by PubChem (NCBI)