CAS 151222-64-9 is the registry number for 4-Fluoro-3,5-dinitrophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-fluoro-3,5-dinitrophenol (CAS 151222-64-9) is a chemical compound with the molecular formula C6H3FN2O5 and a molecular weight of 202.10 g/mol. IUPAC name: 4-fluoro-3,5-dinitrophenol. InChIKey: AOHRUGRXVVCAEE-UHFFFAOYSA-N.
| Molecular formula | C6H3FN2O5 |
|---|---|
| Molecular weight | 202.10 g/mol |
| IUPAC name | 4-fluoro-3,5-dinitrophenol |
| InChIKey | AOHRUGRXVVCAEE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)[N+](=O)[O-])O |
Computed by PubChem (NCBI)