CAS 2265-90-9 appears in our catalog under these names: 2-Fluoro-4,6-dinitrophenol, 95%, 2-Fuoro-4,6-dinitrophenol, 98%, 98%, 2-fluoro-4,6-dinitrophenol, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-fluoro-4,6-dinitrophenol (CAS 2265-90-9) is a chemical compound with the molecular formula C6H3FN2O5 and a molecular weight of 202.10 g/mol. IUPAC name: 2-fluoro-4,6-dinitrophenol. InChIKey: GCFZQMCJLYJALN-UHFFFAOYSA-N.
| Molecular formula | C6H3FN2O5 |
|---|---|
| Molecular weight | 202.10 g/mol |
| IUPAC name | 2-fluoro-4,6-dinitrophenol |
| InChIKey | GCFZQMCJLYJALN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)