CAS 1512316-93-6 is the registry number for 2-(Dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid (CAS 1512316-93-6) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: 2-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid. InChIKey: SMKLRTNSXAESAB-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid |
| InChIKey | SMKLRTNSXAESAB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)