Products 151276-11-8
CAS 151276-11-8 is the registry number for 1,4-dichloro-2-(trifluoromethoxy)benzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,4-dichloro-2-(trifluoromethoxy)benzene (CAS 151276-11-8) is a chemical compound with the molecular formula C7H3Cl2F3O and a molecular weight of 231.00 g/mol. IUPAC name: 1,4-dichloro-2-(trifluoromethoxy)benzene. InChIKey: PTNMLQSNMVBZCO-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O |
|---|---|
| Molecular weight | 231.00 g/mol |
| IUPAC name | 1,4-dichloro-2-(trifluoromethoxy)benzene |
| InChIKey | PTNMLQSNMVBZCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)