Products 151290-73-2
CAS 151290-73-2 is the registry number for 2-Cyano-n-(4,6-dimethylpyrimidin-2-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-cyano-N-(4,6-dimethylpyrimidin-2-yl)acetamide (CAS 151290-73-2) is a chemical compound with the molecular formula C9H10N4O and a molecular weight of 190.20 g/mol. IUPAC name: 2-cyano-N-(4,6-dimethylpyrimidin-2-yl)acetamide. InChIKey: XAYNCBRHNGLKTJ-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2-cyano-N-(4,6-dimethylpyrimidin-2-yl)acetamide |
| InChIKey | XAYNCBRHNGLKTJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC(=O)CC#N)C |
Computed by PubChem (NCBI)