CAS 936074-56-5 is the registry number for 2-Methoxy-5-(4h-1,2,4-triazol-4-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
2-methoxy-5-(1,2,4-triazol-4-yl)aniline (CAS 936074-56-5) is a chemical compound with the molecular formula C9H10N4O and a molecular weight of 190.20 g/mol. IUPAC name: 2-methoxy-5-(1,2,4-triazol-4-yl)aniline. InChIKey: QAMCXBKFKTVIQP-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2-methoxy-5-(1,2,4-triazol-4-yl)aniline |
| InChIKey | QAMCXBKFKTVIQP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2C=NN=C2)N |
Computed by PubChem (NCBI)