CAS 1513119-35-1 appears in our catalog under these names: 2-Amino-6-bromo-3-chloro-5-fluorobenzoic acid, 97%, 2–Amino–6–bromo–3–chloro–5–fluorobenzoic acid, 2-Amino-6-bromo-3-chloro-5-fluorobenzoic acid, 97%, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg.
2-amino-6-bromo-3-chloro-5-fluorobenzoic acid (CAS 1513119-35-1) is a chemical compound with the molecular formula C7H4BrClFNO2 and a molecular weight of 268.47 g/mol. IUPAC name: 2-amino-6-bromo-3-chloro-5-fluorobenzoic acid. InChIKey: WRCZGYIVEVFSBI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClFNO2 |
|---|---|
| Molecular weight | 268.47 g/mol |
| IUPAC name | 2-amino-6-bromo-3-chloro-5-fluorobenzoic acid |
| InChIKey | WRCZGYIVEVFSBI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)N)C(=O)O)Br)F |
Computed by PubChem (NCBI)