Products 2771459-79-9

CAS 2771459-79-9 is the registry number for 2-Amino-4-bromo-3-chloro-5-fluorobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-4-bromo-3-chloro-5-fluorobenzoic acid (CAS 2771459-79-9) is a chemical compound with the molecular formula C7H4BrClFNO2 and a molecular weight of 268.47 g/mol. IUPAC name: 2-amino-4-bromo-3-chloro-5-fluorobenzoic acid. InChIKey: KMZLPUSCDNTYPA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrClFNO2
Molecular weight268.47 g/mol
IUPAC name2-amino-4-bromo-3-chloro-5-fluorobenzoic acid
InChIKeyKMZLPUSCDNTYPA-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1F)Br)Cl)N)C(=O)O

Computed by PubChem (NCBI)