CAS 1513252-53-3 appears in our catalog under these names: 7-Bromo-1H-indole-2-carbonitrile, 95+%, 7-Bromo-1H-indole-2-carbonitrile, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g.
7-bromo-1H-indole-2-carbonitrile (CAS 1513252-53-3) is a chemical compound with the molecular formula C9H5BrN2 and a molecular weight of 221.05 g/mol. IUPAC name: 7-bromo-1H-indole-2-carbonitrile. InChIKey: IJPIUBGFUIGHKF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2 |
|---|---|
| Molecular weight | 221.05 g/mol |
| IUPAC name | 7-bromo-1H-indole-2-carbonitrile |
| InChIKey | IJPIUBGFUIGHKF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=C2)C#N |
Computed by PubChem (NCBI)