CAS 90271-86-6 appears in our catalog under these names: 5-Bromo-3-cyanoindole, 97%, 97%, 5-Bromo-3-cyanoindole, 95%, 5-Bromo-3-cyanoindole, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
5-bromo-1H-indole-3-carbonitrile (CAS 90271-86-6) is a chemical compound with the molecular formula C9H5BrN2 and a molecular weight of 221.05 g/mol. IUPAC name: 5-bromo-1H-indole-3-carbonitrile. InChIKey: ZPUQCVKBNRGSAP-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2 |
|---|---|
| Molecular weight | 221.05 g/mol |
| IUPAC name | 5-bromo-1H-indole-3-carbonitrile |
| InChIKey | ZPUQCVKBNRGSAP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C#N |
Computed by PubChem (NCBI)