Products 1513478-06-2

CAS 1513478-06-2 is the registry number for 3-(6-Fluoro-3,4-dihydroquinoxalin-1(2H)-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(6-fluoro-3,4-dihydro-2H-quinoxalin-1-yl)thiolane 1,1-dioxide (CAS 1513478-06-2) is a chemical compound with the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. IUPAC name: 3-(6-fluoro-3,4-dihydro-2H-quinoxalin-1-yl)thiolane 1,1-dioxide. InChIKey: RLARAZOQSCYWGV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15FN2O2S
Molecular weight270.33 g/mol
IUPAC name3-(6-fluoro-3,4-dihydro-2H-quinoxalin-1-yl)thiolane 1,1-dioxide
InChIKeyRLARAZOQSCYWGV-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1N2CCNC3=C2C=CC(=C3)F

Computed by PubChem (NCBI)