CAS 1924226-89-0 is the registry number for 3-Amino-4-(6-fluoroindolin-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(6-fluoro-2,3-dihydroindol-1-yl)-1,1-dioxothiolan-3-amine (CAS 1924226-89-0) is a chemical compound with the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. IUPAC name: 4-(6-fluoro-2,3-dihydroindol-1-yl)-1,1-dioxothiolan-3-amine. InChIKey: NQROXSPVRDAZNI-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O2S |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | 4-(6-fluoro-2,3-dihydroindol-1-yl)-1,1-dioxothiolan-3-amine |
| InChIKey | NQROXSPVRDAZNI-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=CC(=C2)F)C3CS(=O)(=O)CC3N |
Computed by PubChem (NCBI)