Products 1513848-14-0
CAS 1513848-14-0 appears in our catalog under these names: TRFS–green, Trfs-green, TRFS-green, 97.0%, TRFS-green, 95%, 1,2-Dithiolan-4-yl (2-butyl-1,3-dioxo-2,3-dihydro-1H-benzo[de]isoquinolin-6-yl)carbamate, 95%. Offered by: GLPBio, Biosynth, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 5 mg, 10 mg, 10mM/1mL.
Dithiolan-4-yl N-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamate (CAS 1513848-14-0) is a chemical compound with the molecular formula C20H20N2O4S2 and a molecular weight of 416.5 g/mol. IUPAC name: dithiolan-4-yl N-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamate. InChIKey: MUAYCZWBPDUZKR-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O4S2 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | dithiolan-4-yl N-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamate |
| InChIKey | MUAYCZWBPDUZKR-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C3C(=C(C=C2)NC(=O)OC4CSSC4)C=CC=C3C1=O |
Computed by PubChem (NCBI)