CAS 41595-29-3 is the registry number for N,N'-(1,4-Phenylene)bis(4-methylbenzenesulfonamide), 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]benzenesulfonamide (CAS 41595-29-3) is a chemical compound with the molecular formula C20H20N2O4S2 and a molecular weight of 416.5 g/mol. IUPAC name: 4-methyl-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]benzenesulfonamide. InChIKey: ZUNJCQVFMHRTTP-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O4S2 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | 4-methyl-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]benzenesulfonamide |
| InChIKey | ZUNJCQVFMHRTTP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)NS(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)