CAS 1513855-74-7 is the registry number for N6-[[(4-Azidophenyl)methoxy]carbonyl]-L-lysine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-6-[(4-azidophenyl)methoxycarbonylamino]hexanoic acid (CAS 1513855-74-7) is a chemical compound with the molecular formula C14H19N5O4 and a molecular weight of 321.33 g/mol. IUPAC name: (2S)-2-amino-6-[(4-azidophenyl)methoxycarbonylamino]hexanoic acid. InChIKey: TZQHUQASIQQHCK-LBPRGKRZSA-N.
| Molecular formula | C14H19N5O4 |
|---|---|
| Molecular weight | 321.33 g/mol |
| IUPAC name | (2S)-2-amino-6-[(4-azidophenyl)methoxycarbonylamino]hexanoic acid |
| InChIKey | TZQHUQASIQQHCK-LBPRGKRZSA-N |
| SMILES | C1=CC(=CC=C1COC(=O)NCCCC[C@@H](C(=O)O)N)N=[N+]=[N-] |
Computed by PubChem (NCBI)