Products 1514659-59-6
CAS 1514659-59-6 is the registry number for 4-Chloro-2-(dimethylamino)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-2-(dimethylamino)-1,3-thiazole-5-carboxylic acid (CAS 1514659-59-6) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 4-chloro-2-(dimethylamino)-1,3-thiazole-5-carboxylic acid. InChIKey: DUDVJEMJQSWUCT-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 4-chloro-2-(dimethylamino)-1,3-thiazole-5-carboxylic acid |
| InChIKey | DUDVJEMJQSWUCT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=C(S1)C(=O)O)Cl |
Computed by PubChem (NCBI)