CAS 151490-40-3 appears in our catalog under these names: METHYL (1-METHYLINDOLYL)-3-GLYOXYLATE, &, Methyl 2-(1-methyl-1H-indol-3-yl)-2-oxoacetate. Offered by: Sigma-Aldrich, Biosynth. Available pack sizes: 5G, 100mg, 250mg.
Methyl 2-(1-methylindol-3-yl)-2-oxoacetate (CAS 151490-40-3) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: methyl 2-(1-methylindol-3-yl)-2-oxoacetate. InChIKey: SBHIWUQNUXJUMN-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | methyl 2-(1-methylindol-3-yl)-2-oxoacetate |
| InChIKey | SBHIWUQNUXJUMN-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(=O)C(=O)OC |
Computed by PubChem (NCBI)