Products 151561-88-5
CAS 151561-88-5 is the registry number for 3-Oxokauran-17-oic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,4S,9S,10R,13R,14S)-5,5,9-trimethyl-6-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-14-carboxylic acid (CAS 151561-88-5) is a chemical compound with the molecular formula C20H30O3 and a molecular weight of 318.4 g/mol. IUPAC name: (1S,4S,9S,10R,13R,14S)-5,5,9-trimethyl-6-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-14-carboxylic acid. InChIKey: DFXNQVOKZMHGJK-OAAASAAISA-N.
| Molecular formula | C20H30O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (1S,4S,9S,10R,13R,14S)-5,5,9-trimethyl-6-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-14-carboxylic acid |
| InChIKey | DFXNQVOKZMHGJK-OAAASAAISA-N |
| SMILES | C[C@@]12CCC(=O)C([C@H]1CC[C@]34[C@H]2CC[C@H](C3)[C@H](C4)C(=O)O)(C)C |
Computed by PubChem (NCBI)