CAS 1515653-78-7 is the registry number for 2-((4-Bromophenyl)thio)-2,2-difluoroacetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
2-(4-bromophenyl)sulfanyl-2,2-difluoroacetic acid (CAS 1515653-78-7) is a chemical compound with the molecular formula C8H5BrF2O2S and a molecular weight of 283.09 g/mol. IUPAC name: 2-(4-bromophenyl)sulfanyl-2,2-difluoroacetic acid. InChIKey: DGNCWIMVUCKDBG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2S |
|---|---|
| Molecular weight | 283.09 g/mol |
| IUPAC name | 2-(4-bromophenyl)sulfanyl-2,2-difluoroacetic acid |
| InChIKey | DGNCWIMVUCKDBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1SC(C(=O)O)(F)F)Br |
Computed by PubChem (NCBI)