Products 1515653-78-7

CAS 1515653-78-7 is the registry number for 2-((4-Bromophenyl)thio)-2,2-difluoroacetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(4-bromophenyl)sulfanyl-2,2-difluoroacetic acid (CAS 1515653-78-7) is a chemical compound with the molecular formula C8H5BrF2O2S and a molecular weight of 283.09 g/mol. IUPAC name: 2-(4-bromophenyl)sulfanyl-2,2-difluoroacetic acid. InChIKey: DGNCWIMVUCKDBG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrF2O2S
Molecular weight283.09 g/mol
IUPAC name2-(4-bromophenyl)sulfanyl-2,2-difluoroacetic acid
InChIKeyDGNCWIMVUCKDBG-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1SC(C(=O)O)(F)F)Br

Computed by PubChem (NCBI)