CAS 179184-66-8 is the registry number for 1-(5-Bromothiophen-2-yl)-4,4-difluorobutane-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(5-bromothiophen-2-yl)-4,4-difluorobutane-1,3-dione (CAS 179184-66-8) is a chemical compound with the molecular formula C8H5BrF2O2S and a molecular weight of 283.09 g/mol. IUPAC name: 1-(5-bromothiophen-2-yl)-4,4-difluorobutane-1,3-dione. InChIKey: RHUXKVKYFDUVRG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2S |
|---|---|
| Molecular weight | 283.09 g/mol |
| IUPAC name | 1-(5-bromothiophen-2-yl)-4,4-difluorobutane-1,3-dione |
| InChIKey | RHUXKVKYFDUVRG-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C(=O)CC(=O)C(F)F |
Computed by PubChem (NCBI)