CAS 1515807-30-3 appears in our catalog under these names: Flubendazole EP Impurity D, Flubendazole Impurity 10 (Flubendazole EP Impurity D), (1H-Benzimidazol-5-yl)(4-fluorophenyl)methanone. Offered by: Chemat Brand, Hubei YoungXin, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 4x25mg.
3H-benzimidazol-5-yl-(4-fluorophenyl)methanone (CAS 1515807-30-3) is a chemical compound with the molecular formula C14H9FN2O and a molecular weight of 240.23 g/mol. IUPAC name: 3H-benzimidazol-5-yl-(4-fluorophenyl)methanone. InChIKey: JWCPXLUHKJAEHS-UHFFFAOYSA-N.
| Molecular formula | C14H9FN2O |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | 3H-benzimidazol-5-yl-(4-fluorophenyl)methanone |
| InChIKey | JWCPXLUHKJAEHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC3=C(C=C2)N=CN3)F |
Computed by PubChem (NCBI)