CAS 476296-42-1 is the registry number for 4-Cyano-N-(2-fluorophenyl)benzamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-cyano-N-(2-fluorophenyl)benzamide (CAS 476296-42-1) is a chemical compound with the molecular formula C14H9FN2O and a molecular weight of 240.23 g/mol. IUPAC name: 4-cyano-N-(2-fluorophenyl)benzamide. InChIKey: VSPRNQPPKIBABI-UHFFFAOYSA-N.
| Molecular formula | C14H9FN2O |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | 4-cyano-N-(2-fluorophenyl)benzamide |
| InChIKey | VSPRNQPPKIBABI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)C2=CC=C(C=C2)C#N)F |
Computed by PubChem (NCBI)