Products 1515844-23-1
CAS 1515844-23-1 is the registry number for 2-(6-bromo-2H-indazol-2-yl)acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-(6-bromoindazol-2-yl)acetic acid (CAS 1515844-23-1) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 2-(6-bromoindazol-2-yl)acetic acid. InChIKey: PTJQWNWSHMILOH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 2-(6-bromoindazol-2-yl)acetic acid |
| InChIKey | PTJQWNWSHMILOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN(N=C2C=C1Br)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2H-Indazole-2-acetic acid, 6-bromo-