Products 1515855-85-2

CAS 1515855-85-2 is the registry number for AKU-005, 99.48%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 100 mg, 50 mg, 10mM/1mL, 25 mg, 10 mg.

Structural formula: {0} (CAS {1})

(4-benzhydrylpiperazin-1-yl)-(1,2,4-triazol-1-yl)methanone (CAS 1515855-85-2) is a chemical compound with the molecular formula C20H21N5O and a molecular weight of 347.4 g/mol. IUPAC name: (4-benzhydrylpiperazin-1-yl)-(1,2,4-triazol-1-yl)methanone. InChIKey: DAHGNJMKRWHRFF-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21N5O
Molecular weight347.4 g/mol
IUPAC name(4-benzhydrylpiperazin-1-yl)-(1,2,4-triazol-1-yl)methanone
InChIKeyDAHGNJMKRWHRFF-UHFFFAOYSA-N
SMILESC1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)N4C=NC=N4

Computed by PubChem (NCBI)

Synonyms: orb2646093