Products 379247-14-0

CAS 379247-14-0 is the registry number for Histamine H4 receptor antagonist-2. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

5-[3-(dimethylamino)propylamino]quinazolino[2,3-a]phthalazin-8-one (CAS 379247-14-0) is a chemical compound with the molecular formula C20H21N5O and a molecular weight of 347.4 g/mol. IUPAC name: 5-[3-(dimethylamino)propylamino]quinazolino[2,3-a]phthalazin-8-one. InChIKey: VYNPQVGFXYNKOX-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21N5O
Molecular weight347.4 g/mol
IUPAC name5-[3-(dimethylamino)propylamino]quinazolino[2,3-a]phthalazin-8-one
InChIKeyVYNPQVGFXYNKOX-UHFFFAOYSA-N
SMILESCN(C)CCCNC1=NN2C(=NC3=CC=CC=C3C2=O)C4=CC=CC=C41

Computed by PubChem (NCBI)