CAS 1515861-67-2 appears in our catalog under these names: n-Decyl-d21-trimethylammonium Bromide, n-Decyl-d21-trimethylammonium Bromide, 98 atom % D, min 98% Chemical Purity, Decyltrimethylammonium-d21 (bromide), 99.90%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 1 mg, 50 mg, 25 mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosadeuteriodecyl(trimethyl)azanium bromide (CAS 1515861-67-2) is a chemical compound with the molecular formula C13H30BrN and a molecular weight of 301.42 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosadeuteriodecyl(trimethyl)azanium bromide. InChIKey: PLMFYJJFUUUCRZ-KYIJYTBRSA-M.
| Molecular formula | C13H30BrN |
|---|---|
| Molecular weight | 301.42 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosadeuteriodecyl(trimethyl)azanium bromide |
| InChIKey | PLMFYJJFUUUCRZ-KYIJYTBRSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[N+](C)(C)C.[Br-] |
Computed by PubChem (NCBI)