CAS 37026-88-3 appears in our catalog under these names: Tributylmethylammonium bromide, 95%, Tributylmethylammonium bromide, N-Methyl-N,N-dipentylpentan-1-aminium bromide 98%, TRIBUTYLMETHYLAMMONIUM BROMIDE, >=98.0%, Tributylmethylammonium bromide, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 500g.
Tributyl(methyl)azanium bromide (CAS 37026-88-3) is a chemical compound with the molecular formula C13H30BrN and a molecular weight of 280.29 g/mol. IUPAC name: tributyl(methyl)azanium bromide. InChIKey: DHAWHVVWUNNONG-UHFFFAOYSA-M.
| Molecular formula | C13H30BrN |
|---|---|
| Molecular weight | 280.29 g/mol |
| IUPAC name | tributyl(methyl)azanium bromide |
| InChIKey | DHAWHVVWUNNONG-UHFFFAOYSA-M |
| SMILES | CCCC[N+](C)(CCCC)CCCC.[Br-] |
Computed by PubChem (NCBI)