CAS 1516298-29-5 appears in our catalog under these names: 1-Bromo-2-(chloromethyl)-3-fluoro-4-methoxybenzene, 97%, 1-Bromo-2-(chloromethyl)-3-fluoro-4-methoxybenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
1-bromo-2-(chloromethyl)-3-fluoro-4-methoxybenzene (CAS 1516298-29-5) is a chemical compound with the molecular formula C8H7BrClFO and a molecular weight of 253.49 g/mol. IUPAC name: 1-bromo-2-(chloromethyl)-3-fluoro-4-methoxybenzene. InChIKey: AGVZIBPTPUDSHV-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClFO |
|---|---|
| Molecular weight | 253.49 g/mol |
| IUPAC name | 1-bromo-2-(chloromethyl)-3-fluoro-4-methoxybenzene |
| InChIKey | AGVZIBPTPUDSHV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)CCl)F |
Computed by PubChem (NCBI)