Products 886499-54-3
CAS 886499-54-3 appears in our catalog under these names: 2-Chloro-6-fluoro-3-methoxybenzyl bromide, 95%, 2-Chloro-6-fluoro-3-methoxybenzyl bromide, 95+%, 2-Chloro-6-fluoro-3-methoxybenzyl bromide, 95%, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg.
2-(bromomethyl)-3-chloro-1-fluoro-4-methoxybenzene (CAS 886499-54-3) is a chemical compound with the molecular formula C8H7BrClFO and a molecular weight of 253.49 g/mol. IUPAC name: 2-(bromomethyl)-3-chloro-1-fluoro-4-methoxybenzene. InChIKey: BIXHHCSLGATAOQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClFO |
|---|---|
| Molecular weight | 253.49 g/mol |
| IUPAC name | 2-(bromomethyl)-3-chloro-1-fluoro-4-methoxybenzene |
| InChIKey | BIXHHCSLGATAOQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)CBr)Cl |
Computed by PubChem (NCBI)