Products 1516757-44-0
CAS 1516757-44-0 appears in our catalog under these names: 4-(3-Bromothiophen-2-yl)-N-methylpyrimidin-2-amine, 95%, 4-(3-Bromothiophen-2-yl)-N-methylpyrimidin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(3-bromothiophen-2-yl)-N-methylpyrimidin-2-amine (CAS 1516757-44-0) is a chemical compound with the molecular formula C9H8BrN3S and a molecular weight of 270.15 g/mol. IUPAC name: 4-(3-bromothiophen-2-yl)-N-methylpyrimidin-2-amine. InChIKey: KOEKKSUTIVXDDT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3S |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | 4-(3-bromothiophen-2-yl)-N-methylpyrimidin-2-amine |
| InChIKey | KOEKKSUTIVXDDT-UHFFFAOYSA-N |
| SMILES | CNC1=NC=CC(=N1)C2=C(C=CS2)Br |
Computed by PubChem (NCBI)