Products 1517876-44-6

CAS 1517876-44-6 is the registry number for Ethyl 4-methoxy-4-methyl-3-oxopentanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 4-methoxy-4-methyl-3-oxopentanoate (CAS 1517876-44-6) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: ethyl 4-methoxy-4-methyl-3-oxopentanoate. InChIKey: RWSBGTCSZBMEMW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O4
Molecular weight188.22 g/mol
IUPAC nameethyl 4-methoxy-4-methyl-3-oxopentanoate
InChIKeyRWSBGTCSZBMEMW-UHFFFAOYSA-N
SMILESCCOC(=O)CC(=O)C(C)(C)OC

Computed by PubChem (NCBI)