CAS 151831-52-6 is the registry number for (S)-1,2,3,4-Tetrahydro-1-naphthalenemethanol. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanol (CAS 151831-52-6) is a chemical compound with the molecular formula C11H14O and a molecular weight of 162.23 g/mol. IUPAC name: [(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanol. InChIKey: LBARXHIIOCOWOG-SNVBAGLBSA-N.
| Molecular formula | C11H14O |
|---|---|
| Molecular weight | 162.23 g/mol |
| IUPAC name | [(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanol |
| InChIKey | LBARXHIIOCOWOG-SNVBAGLBSA-N |
| SMILES | C1C[C@@H](C2=CC=CC=C2C1)CO |
Computed by PubChem (NCBI)