Products 15185-02-1
CAS 15185-02-1 is the registry number for Benzyl-alpha,alpha-d2-amine, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
Dideuterio(phenyl)methanamine (CAS 15185-02-1) is a chemical compound with the molecular formula C7H9N and a molecular weight of 109.17 g/mol. IUPAC name: dideuterio(phenyl)methanamine. InChIKey: WGQKYBSKWIADBV-NCYHJHSESA-N.
| Molecular formula | C7H9N |
|---|---|
| Molecular weight | 109.17 g/mol |
| IUPAC name | dideuterio(phenyl)methanamine |
| InChIKey | WGQKYBSKWIADBV-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(C1=CC=CC=C1)N |
Computed by PubChem (NCBI)