CAS 167750-79-0 appears in our catalog under these names: Benzylamine-d7, >95% (HPLC), Benzyl-d7-amine, 99 atom % D, min 98% Chemical Purity, Benzylamine–d7, Benzene-d5-methan-d2-amine(9ci). Offered by: TRC, CDN, GLPBio, Biosynth. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 25mg, 50mg.
Dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanamine (CAS 167750-79-0) is a chemical compound with the molecular formula C7H9N and a molecular weight of 114.20 g/mol. IUPAC name: dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanamine. InChIKey: WGQKYBSKWIADBV-XZJKGWKKSA-N.
| Molecular formula | C7H9N |
|---|---|
| Molecular weight | 114.20 g/mol |
| IUPAC name | dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanamine |
| InChIKey | WGQKYBSKWIADBV-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])N)[2H])[2H] |
Computed by PubChem (NCBI)