CAS 151868-16-5 appears in our catalog under these names: 2-Fluoro-N,N-dimethylbenzene-1-sulfonamide, 95%, 2-Fluoro-N,N-dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-fluoro-N,N-dimethylbenzenesulfonamide (CAS 151868-16-5) is a chemical compound with the molecular formula C8H10FNO2S and a molecular weight of 203.24 g/mol. IUPAC name: 2-fluoro-N,N-dimethylbenzenesulfonamide. InChIKey: BSZOPXBTMLYXSG-UHFFFAOYSA-N.
| Molecular formula | C8H10FNO2S |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-fluoro-N,N-dimethylbenzenesulfonamide |
| InChIKey | BSZOPXBTMLYXSG-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1F |
Computed by PubChem (NCBI)