Products 151899-07-9
CAS 151899-07-9 appears in our catalog under these names: (R)–2–Amino–3–cyclohexylpropanoic acid hydrochloride, H-D-CHA-OH HCL, 97%, 97%, (R)-2-Amino-3-cyclohexylpropanoic acid hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g.
(2R)-2-amino-3-cyclohexylpropanoic acid;hydrochloride (CAS 151899-07-9) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: (2R)-2-amino-3-cyclohexylpropanoic acid;hydrochloride. InChIKey: QNGGSVANUAULGK-DDWIOCJRSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (2R)-2-amino-3-cyclohexylpropanoic acid;hydrochloride |
| InChIKey | QNGGSVANUAULGK-DDWIOCJRSA-N |
| SMILES | C1CCC(CC1)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-Amino-3-cyclohexylpropanoic acid hydrochloride, H-D-CHA-OH HCL, (2R)-2-amino-3-cyclohexylpropanoic acid;hydrochloride, 3-Cyclohexyl-D-alanine hydrochloride, H-D-ChaOH.HCl, H-D-Cha-OH.HCl, H-D-Cha-OH hydrochloride, QNGGSVANUAULGK-DDWIOCJRSA-N, beta-cyclohexyl-(D)-alanine hydrochloride, (R)-2-Amino-3-cyclohexylpropanoicacidhydrochloride