CAS 151907-80-1 appears in our catalog under these names: Peramivir Impurity 35, (1R,4S)–(+)–4–(Boc–amino)–2–cyclopentene–1–carboxylic acid, (1S,4R)-N-BOC-1-Aminocyclopent-2-ene-4-carboxylic acid, 95%, 98% ee, (1R,4S)-4-(Boc-amino)cyclopent-2-enecarboxylic acid 95%, (1R,4S)-Boc-4-aminocyclopent-2-ene-carboxylic acid, 95%, 95%. Offered by: Chemat Brand, GLPBio, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: on request, 10g, 1g, 5g, 250mg.
(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylic acid (CAS 151907-80-1) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: (1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylic acid. InChIKey: WOUNTSATDZJBLP-JGVFFNPUSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylic acid |
| InChIKey | WOUNTSATDZJBLP-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](C=C1)C(=O)O |
Computed by PubChem (NCBI)