CAS 1519179-15-7 is the registry number for 2-N-(2-(4-Fluorophenyl)ethyl)-1,3-benzoxazole-2,6-diamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-N-[2-(4-fluorophenyl)ethyl]-1,3-benzoxazole-2,6-diamine (CAS 1519179-15-7) is a chemical compound with the molecular formula C15H14FN3O and a molecular weight of 271.29 g/mol. IUPAC name: 2-N-[2-(4-fluorophenyl)ethyl]-1,3-benzoxazole-2,6-diamine. InChIKey: WPUBWYHCIXWBHQ-UHFFFAOYSA-N.
| Molecular formula | C15H14FN3O |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 2-N-[2-(4-fluorophenyl)ethyl]-1,3-benzoxazole-2,6-diamine |
| InChIKey | WPUBWYHCIXWBHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCNC2=NC3=C(O2)C=C(C=C3)N)F |
Computed by PubChem (NCBI)