CAS 364339-37-7 appears in our catalog under these names: 1-(2-(4-Fluorophenoxy)ethyl)-1H-benzo(d)imidazol-2-amine, 97%, 1-[2-(4-Fluorophenoxy)ethyl]-1H-benzoimidazol-2-ylamine, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
1-[2-(4-fluorophenoxy)ethyl]benzimidazol-2-amine (CAS 364339-37-7) is a chemical compound with the molecular formula C15H14FN3O and a molecular weight of 271.29 g/mol. IUPAC name: 1-[2-(4-fluorophenoxy)ethyl]benzimidazol-2-amine. InChIKey: DLOUTXSVOGNYMI-UHFFFAOYSA-N.
| Molecular formula | C15H14FN3O |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 1-[2-(4-fluorophenoxy)ethyl]benzimidazol-2-amine |
| InChIKey | DLOUTXSVOGNYMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2CCOC3=CC=C(C=C3)F)N |
Computed by PubChem (NCBI)