Products 1519427-10-1
CAS 1519427-10-1 is the registry number for 2-Bromo-1-(5-bromo-4-chlorothiophen-2-yl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(5-bromo-4-chlorothiophen-2-yl)ethanone (CAS 1519427-10-1) is a chemical compound with the molecular formula C6H3Br2ClOS and a molecular weight of 318.41 g/mol. IUPAC name: 2-bromo-1-(5-bromo-4-chlorothiophen-2-yl)ethanone. InChIKey: LGQUMOJPBSNHMJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2ClOS |
|---|---|
| Molecular weight | 318.41 g/mol |
| IUPAC name | 2-bromo-1-(5-bromo-4-chlorothiophen-2-yl)ethanone |
| InChIKey | LGQUMOJPBSNHMJ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Cl)Br)C(=O)CBr |
Computed by PubChem (NCBI)