Products 1520-59-8
CAS 1520-59-8 is the registry number for Cyclohexane-d11, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1,1,2,2,3,3,4,4,5,5,6-undecadeuteriocyclohexane (CAS 1520-59-8) is a chemical compound with the molecular formula C6H12 and a molecular weight of 95.23 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6-undecadeuteriocyclohexane. InChIKey: XDTMQSROBMDMFD-WTVBDOPLSA-N.
| Molecular formula | C6H12 |
|---|---|
| Molecular weight | 95.23 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6-undecadeuteriocyclohexane |
| InChIKey | XDTMQSROBMDMFD-WTVBDOPLSA-N |
| SMILES | [2H]C1C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H] |
Computed by PubChem (NCBI)